C13H9BrF2O2 — CID 107100181
[2-(5-bromo-2,3-difluorophenoxy)phenyl]methanol (PubChem CID 107100181) has the molecular formula C13H9BrF2O2 and a molecular weight of 315.11 g/mol. Its IUPAC name is [2-(5-bromo-2,3-difluorophenoxy)phenyl]methanol.
| Compound Name | [2-(5-bromo-2,3-difluorophenoxy)phenyl]methanol |
|---|---|
| PubChem CID | 107100181 |
| Molecular Formula | C13H9BrF2O2 |
| Molecular Weight | 315.11 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | [2-(5-bromo-2,3-difluorophenoxy)phenyl]methanol |
| SMILES | OCc1ccccc1Oc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C13H9BrF2O2/c14-9-5-10(15)13(16)12(6-9)18-11-4-2-1-3-8(11)7-17/h1-6,17H,7H2 |
| InChIKey | PTNOBGDJXJQGGJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.11 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|