C12H9BrF2N2O — CID 107097306
[3-(5-bromo-2,3-difluorophenoxy)-2-pyridinyl]methanamine (PubChem CID 107097306) has the molecular formula C12H9BrF2N2O and a molecular weight of 315.12 g/mol. Its IUPAC name is [3-(5-bromo-2,3-difluorophenoxy)-2-pyridinyl]methanamine.
| Compound Name | [3-(5-bromo-2,3-difluorophenoxy)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 107097306 |
| Molecular Formula | C12H9BrF2N2O |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | [3-(5-bromo-2,3-difluorophenoxy)-2-pyridinyl]methanamine |
| SMILES | NCc1ncccc1Oc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C12H9BrF2N2O/c13-7-4-8(14)12(15)11(5-7)18-10-2-1-3-17-9(10)6-16/h1-5H,6,16H2 |
| InChIKey | BBSPFOATCMZETB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|