C14H10BrF2NO3 — CID 107099524
ethyl 2-(5-bromo-2,3-difluorophenoxy)pyridine-3-carboxylate (PubChem CID 107099524) has the molecular formula C14H10BrF2NO3 and a molecular weight of 358.14 g/mol. Its IUPAC name is ethyl 2-(5-bromo-2,3-difluorophenoxy)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(5-bromo-2,3-difluorophenoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 107099524 |
| Molecular Formula | C14H10BrF2NO3 |
| Molecular Weight | 358.14 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | ethyl 2-(5-bromo-2,3-difluorophenoxy)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1Oc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C14H10BrF2NO3/c1-2-20-14(19)9-4-3-5-18-13(9)21-11-7-8(15)6-10(16)12(11)17/h3-7H,2H2,1H3 |
| InChIKey | IJTMUCDWOUJYPZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.14 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|