C8H9F2NO2 — CID 115507300
2-(2-amino-3,5-difluorophenoxy)ethanol (PubChem CID 115507300) has the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. Its IUPAC name is 2-(2-amino-3,5-difluorophenoxy)ethanol.
| Compound Name | 2-(2-amino-3,5-difluorophenoxy)ethanol |
|---|---|
| PubChem CID | 115507300 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-(2-amino-3,5-difluorophenoxy)ethanol |
| SMILES | Nc1c(F)cc(F)cc1OCCO |
| InChI | InChI=1S/C8H9F2NO2/c9-5-3-6(10)8(11)7(4-5)13-2-1-12/h3-4,12H,1-2,11H2 |
| InChIKey | ZDWABOJCXAANFA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|