C8H7F3O2 — CID 117051245
2-(2,3,4-trifluorophenoxy)ethanol (PubChem CID 117051245) has the molecular formula C8H7F3O2 and a molecular weight of 192.14 g/mol. Its IUPAC name is 2-(2,3,4-trifluorophenoxy)ethanol.
| Compound Name | 2-(2,3,4-trifluorophenoxy)ethanol |
|---|---|
| PubChem CID | 117051245 |
| Molecular Formula | C8H7F3O2 |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 2-(2,3,4-trifluorophenoxy)ethanol |
| SMILES | OCCOc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C8H7F3O2/c9-5-1-2-6(13-4-3-12)8(11)7(5)10/h1-2,12H,3-4H2 |
| InChIKey | GCCMFLXEOWUJGN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|