C12H18O4 — CID 14025005
2-[4-(2-hydroxyethoxy)-2,3-dimethylphenoxy]ethanol (PubChem CID 14025005) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethoxy)-2,3-dimethylphenoxy]ethanol.
| Compound Name | 2-[4-(2-hydroxyethoxy)-2,3-dimethylphenoxy]ethanol |
|---|---|
| PubChem CID | 14025005 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-[4-(2-hydroxyethoxy)-2,3-dimethylphenoxy]ethanol |
| SMILES | Cc1c(OCCO)ccc(OCCO)c1C |
| InChI | InChI=1S/C12H18O4/c1-9-10(2)12(16-8-6-14)4-3-11(9)15-7-5-13/h3-4,13-14H,5-8H2,1-2H3 |
| InChIKey | JVDWXBMYXSBAAR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |