C42H57N3O9 — CID 171784743
2-[6-[4,6-bis[4-butoxy-2-(2-hydroxyethoxy)-3-methylphenyl]-1,3,5-triazin-2-yl]-3-butoxy-2-methylphenoxy]ethanol (PubChem CID 171784743) has the molecular formula C42H57N3O9 and a molecular weight of 747.93 g/mol. Its IUPAC name is 2-[6-[4,6-bis[4-butoxy-2-(2-hydroxyethoxy)-3-methylphenyl]-1,3,5-triazin-2-yl]-3-butoxy-2-methylphenoxy]ethanol.
| Compound Name | 2-[6-[4,6-bis[4-butoxy-2-(2-hydroxyethoxy)-3-methylphenyl]-1,3,5-triazin-2-yl]-3-butoxy-2-methylphenoxy]ethanol |
|---|---|
| PubChem CID | 171784743 |
| Molecular Formula | C42H57N3O9 |
| Molecular Weight | 747.93 g/mol |
| Exact Mass | 747.41 |
| IUPAC Name | 2-[6-[4,6-bis[4-butoxy-2-(2-hydroxyethoxy)-3-methylphenyl]-1,3,5-triazin-2-yl]-3-butoxy-2-methylphenoxy]ethanol |
| SMILES | CCCCOc1ccc(-c2nc(-c3ccc(OCCCC)c(C)c3OCCO)nc(-c3ccc(OCCCC)c(C)c3OCCO)n2)c(OCCO)c1C |
| InChI | InChI=1S/C42H57N3O9/c1-7-10-22-49-34-16-13-31(37(28(34)4)52-25-19-46)40-43-41(32-14-17-35(50-23-11-8-2)29(5)38(32)53-26-20-47)45-42(44-40)33-15-18-36(51-24-12-9-3)30(6)39(33)54-27-21-48/h13-18,46-48H,7-12,19-27H2,1-6H3 |
| InChIKey | GVCSZKOLEVEAIL-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.93 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|