C39H51N3O5 — CID 137375478
2-[4,6-bis(4-butoxy-2-methylphenyl)-1,3,5-triazin-2-yl]-3,5-dibutoxyphenol (PubChem CID 137375478) has the molecular formula C39H51N3O5 and a molecular weight of 641.85 g/mol. Its IUPAC name is 2-[4,6-bis(4-butoxy-2-methylphenyl)-1,3,5-triazin-2-yl]-3,5-dibutoxyphenol.
| Compound Name | 2-[4,6-bis(4-butoxy-2-methylphenyl)-1,3,5-triazin-2-yl]-3,5-dibutoxyphenol |
|---|---|
| PubChem CID | 137375478 |
| Molecular Formula | C39H51N3O5 |
| Molecular Weight | 641.85 g/mol |
| Exact Mass | 641.38 |
| IUPAC Name | 2-[4,6-bis(4-butoxy-2-methylphenyl)-1,3,5-triazin-2-yl]-3,5-dibutoxyphenol |
| SMILES | CCCCOc1ccc(-c2nc(-c3ccc(OCCCC)cc3C)nc(-c3c(O)cc(OCCCC)cc3OCCCC)n2)c(C)c1 |
| InChI | InChI=1S/C39H51N3O5/c1-7-11-19-44-29-15-17-32(27(5)23-29)37-40-38(33-18-16-30(24-28(33)6)45-20-12-8-2)42-39(41-37)36-34(43)25-31(46-21-13-9-3)26-35(36)47-22-14-10-4/h15-18,23-26,43H,7-14,19-22H2,1-6H3 |
| InChIKey | SMKWBYDRXUZZJK-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.85 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|