C65H78N6O8 — CID 160511620
bis(2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(3-butoxy-2-hydroxypropoxy)phenol);methane (PubChem CID 160511620) has the molecular formula C65H78N6O8 and a molecular weight of 1071.37 g/mol. Its IUPAC name is bis(2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(3-butoxy-2-hydroxypropoxy)phenol);methane.
| Compound Name | bis(2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(3-butoxy-2-hydroxypropoxy)phenol);methane |
|---|---|
| PubChem CID | 160511620 |
| Molecular Formula | C65H78N6O8 |
| Molecular Weight | 1071.37 g/mol |
| Exact Mass | 1070.59 |
| IUPAC Name | bis(2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(3-butoxy-2-hydroxypropoxy)phenol);methane |
| SMILES | C.CCCCOCC(O)COc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1.CCCCOCC(O)COc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1 |
| InChI | InChI=1S/2C32H37N3O4.CH4/c2*1-6-7-14-38-18-24(36)19-39-25-10-13-28(29(37)17-25)32-34-30(26-11-8-20(2)15-22(26)4)33-31(35-32)27-12-9-21(3)16-23(27)5;/h2*8-13,15-17,24,36-37H,6-7,14,18-19H2,1-5H3;1H4 |
| InChIKey | QTCSQVOAIKYYHC-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 195.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.37 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|