C31H43N3O4 — CID 155733634
5-(3-decoxy-2-hydroxypropoxy)-2-[4-(2,4-dimethylphenyl)-6-methyl-1,3,5-triazin-2-yl]phenol (PubChem CID 155733634) has the molecular formula C31H43N3O4 and a molecular weight of 521.70 g/mol. Its IUPAC name is 5-(3-decoxy-2-hydroxypropoxy)-2-[4-(2,4-dimethylphenyl)-6-methyl-1,3,5-triazin-2-yl]phenol.
| Compound Name | 5-(3-decoxy-2-hydroxypropoxy)-2-[4-(2,4-dimethylphenyl)-6-methyl-1,3,5-triazin-2-yl]phenol |
|---|---|
| PubChem CID | 155733634 |
| Molecular Formula | C31H43N3O4 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | 5-(3-decoxy-2-hydroxypropoxy)-2-[4-(2,4-dimethylphenyl)-6-methyl-1,3,5-triazin-2-yl]phenol |
| SMILES | CCCCCCCCCCOCC(O)COc1ccc(-c2nc(C)nc(-c3ccc(C)cc3C)n2)c(O)c1 |
| InChI | InChI=1S/C31H43N3O4/c1-5-6-7-8-9-10-11-12-17-37-20-25(35)21-38-26-14-16-28(29(36)19-26)31-33-24(4)32-30(34-31)27-15-13-22(2)18-23(27)3/h13-16,18-19,25,35-36H,5-12,17,20-21H2,1-4H3 |
| InChIKey | DOCFCCGILVAFIW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|