C40H51N3O8 — CID 169156363
methyl 2-[4-[4,6-bis(4-hexoxy-2-hydroxy-3-methylphenyl)-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]propanoate (PubChem CID 169156363) has the molecular formula C40H51N3O8 and a molecular weight of 701.86 g/mol. Its IUPAC name is methyl 2-[4-[4,6-bis(4-hexoxy-2-hydroxy-3-methylphenyl)-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]propanoate.
| Compound Name | methyl 2-[4-[4,6-bis(4-hexoxy-2-hydroxy-3-methylphenyl)-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]propanoate |
|---|---|
| PubChem CID | 169156363 |
| Molecular Formula | C40H51N3O8 |
| Molecular Weight | 701.86 g/mol |
| Exact Mass | 701.37 |
| IUPAC Name | methyl 2-[4-[4,6-bis(4-hexoxy-2-hydroxy-3-methylphenyl)-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]propanoate |
| SMILES | CCCCCCOc1ccc(-c2nc(-c3ccc(OCCCCCC)c(C)c3O)nc(-c3ccc(OC(C)C(=O)OC)c(C)c3O)n2)c(O)c1C |
| InChI | InChI=1S/C40H51N3O8/c1-8-10-12-14-22-49-31-19-16-28(34(44)24(31)3)37-41-38(29-17-20-32(25(4)35(29)45)50-23-15-13-11-9-2)43-39(42-37)30-18-21-33(26(5)36(30)46)51-27(6)40(47)48-7/h16-21,27,44-46H,8-15,22-23H2,1-7H3 |
| InChIKey | IRTBUILVLBGYFQ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.86 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|