C54H69N3O12 — CID 136927202
6-[4-[4,6-bis[2-hydroxy-3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 136927202) has the molecular formula C54H69N3O12 and a molecular weight of 952.15 g/mol. Its IUPAC name is 6-[4-[4,6-bis[2-hydroxy-3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[4,6-bis[2-hydroxy-3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 136927202 |
| Molecular Formula | C54H69N3O12 |
| Molecular Weight | 952.15 g/mol |
| Exact Mass | 951.49 |
| IUPAC Name | 6-[4-[4,6-bis[2-hydroxy-3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(-c2nc(-c3ccc(OCCCCCCOC(=O)C(=C)C)c(C)c3O)nc(-c3ccc(OCCCCCCOC(=O)C(=C)C)c(C)c3O)n2)c(O)c1C |
| InChI | InChI=1S/C54H69N3O12/c1-34(2)52(61)67-31-19-13-10-16-28-64-43-25-22-40(46(58)37(43)7)49-55-50(41-23-26-44(38(8)47(41)59)65-29-17-11-14-20-32-68-53(62)35(3)4)57-51(56-49)42-24-27-45(39(9)48(42)60)66-30-18-12-15-21-33-69-54(63)36(5)6/h22-27,58-60H,1,3,5,10-21,28-33H2,2,4,6-9H3 |
| InChIKey | WTNGEHIWRRLAOJ-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 205.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.15 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|