C10H14O6 — CID 18513327
3,6-bis(2-hydroxyethoxy)benzene-1,2-diol (PubChem CID 18513327) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is 3,6-bis(2-hydroxyethoxy)benzene-1,2-diol.
| Compound Name | 3,6-bis(2-hydroxyethoxy)benzene-1,2-diol |
|---|---|
| PubChem CID | 18513327 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3,6-bis(2-hydroxyethoxy)benzene-1,2-diol |
| SMILES | OCCOc1ccc(OCCO)c(O)c1O |
| InChI | InChI=1S/C10H14O6/c11-3-5-15-7-1-2-8(16-6-4-12)10(14)9(7)13/h1-2,11-14H,3-6H2 |
| InChIKey | GKZLOEKHKAFWRA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|