C8H8F3NO2 — CID 19370611
O-[2-(2,3,4-trifluorophenoxy)ethyl]hydroxylamine (PubChem CID 19370611) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is O-[2-(2,3,4-trifluorophenoxy)ethyl]hydroxylamine.
| Compound Name | O-[2-(2,3,4-trifluorophenoxy)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 19370611 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | O-[2-(2,3,4-trifluorophenoxy)ethyl]hydroxylamine |
| SMILES | NOCCOc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C8H8F3NO2/c9-5-1-2-6(8(11)7(5)10)13-3-4-14-12/h1-2H,3-4,12H2 |
| InChIKey | UYZQEQNLBQBDLB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|