C9H11F2NO2 — CID 117291282
O-[2-(2,6-difluoro-3-methoxyphenyl)ethyl]hydroxylamine (PubChem CID 117291282) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is O-[2-(2,6-difluoro-3-methoxyphenyl)ethyl]hydroxylamine.
| Compound Name | O-[2-(2,6-difluoro-3-methoxyphenyl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117291282 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | O-[2-(2,6-difluoro-3-methoxyphenyl)ethyl]hydroxylamine |
| SMILES | COc1ccc(F)c(CCON)c1F |
| InChI | InChI=1S/C9H11F2NO2/c1-13-8-3-2-7(10)6(9(8)11)4-5-14-12/h2-3H,4-5,12H2,1H3 |
| InChIKey | XHINSIMBCCZZNW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|