C9H10F2O2 — CID 118830405
1-fluoro-2-(fluoromethyl)-3,4-dimethoxybenzene (PubChem CID 118830405) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is 1-fluoro-2-(fluoromethyl)-3,4-dimethoxybenzene.
| Compound Name | 1-fluoro-2-(fluoromethyl)-3,4-dimethoxybenzene |
|---|---|
| PubChem CID | 118830405 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1-fluoro-2-(fluoromethyl)-3,4-dimethoxybenzene |
| SMILES | COc1ccc(F)c(CF)c1OC |
| InChI | InChI=1S/C9H10F2O2/c1-12-8-4-3-7(11)6(5-10)9(8)13-2/h3-4H,5H2,1-2H3 |
| InChIKey | BESJXRCDYSFITA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |