C9H10ClFO2 — CID 130954694
3-(chloromethyl)-1-fluoro-2,4-dimethoxybenzene (PubChem CID 130954694) has the molecular formula C9H10ClFO2 and a molecular weight of 204.63 g/mol. Its IUPAC name is 3-(chloromethyl)-1-fluoro-2,4-dimethoxybenzene.
| Compound Name | 3-(chloromethyl)-1-fluoro-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 130954694 |
| Molecular Formula | C9H10ClFO2 |
| Molecular Weight | 204.63 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 3-(chloromethyl)-1-fluoro-2,4-dimethoxybenzene |
| SMILES | COc1ccc(F)c(OC)c1CCl |
| InChI | InChI=1S/C9H10ClFO2/c1-12-8-4-3-7(11)9(13-2)6(8)5-10/h3-4H,5H2,1-2H3 |
| InChIKey | COLXPVVSPDKJGL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.63 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|