C8H9F2NO2 — CID 117281310
N-[(3,6-difluoro-2-methoxyphenyl)methyl]hydroxylamine (PubChem CID 117281310) has the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. Its IUPAC name is N-[(3,6-difluoro-2-methoxyphenyl)methyl]hydroxylamine.
| Compound Name | N-[(3,6-difluoro-2-methoxyphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117281310 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | N-[(3,6-difluoro-2-methoxyphenyl)methyl]hydroxylamine |
| SMILES | COc1c(F)ccc(F)c1CNO |
| InChI | InChI=1S/C8H9F2NO2/c1-13-8-5(4-11-12)6(9)2-3-7(8)10/h2-3,11-12H,4H2,1H3 |
| InChIKey | JMJOZKVYBSUHRZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|