C9H11BrFNO3 — CID 117449341
N-[(6-bromo-4-fluoro-2,3-dimethoxyphenyl)methyl]hydroxylamine (PubChem CID 117449341) has the molecular formula C9H11BrFNO3 and a molecular weight of 280.09 g/mol. Its IUPAC name is N-[(6-bromo-4-fluoro-2,3-dimethoxyphenyl)methyl]hydroxylamine.
| Compound Name | N-[(6-bromo-4-fluoro-2,3-dimethoxyphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117449341 |
| Molecular Formula | C9H11BrFNO3 |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | N-[(6-bromo-4-fluoro-2,3-dimethoxyphenyl)methyl]hydroxylamine |
| SMILES | COc1c(F)cc(Br)c(CNO)c1OC |
| InChI | InChI=1S/C9H11BrFNO3/c1-14-8-5(4-12-13)6(10)3-7(11)9(8)15-2/h3,12-13H,4H2,1-2H3 |
| InChIKey | COHPLQTZHROTRN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|