C9H12FNO3 — CID 84776126
N-[(3-fluoro-2,4-dimethoxyphenyl)methyl]hydroxylamine (PubChem CID 84776126) has the molecular formula C9H12FNO3 and a molecular weight of 201.20 g/mol. Its IUPAC name is N-[(3-fluoro-2,4-dimethoxyphenyl)methyl]hydroxylamine.
| Compound Name | N-[(3-fluoro-2,4-dimethoxyphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 84776126 |
| Molecular Formula | C9H12FNO3 |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | N-[(3-fluoro-2,4-dimethoxyphenyl)methyl]hydroxylamine |
| SMILES | COc1ccc(CNO)c(OC)c1F |
| InChI | InChI=1S/C9H12FNO3/c1-13-7-4-3-6(5-11-12)9(14-2)8(7)10/h3-4,11-12H,5H2,1-2H3 |
| InChIKey | URJGKRAGTDWKFP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|