C10H15NO3 — CID 117287016
N-[(2,3-dimethoxy-5-methylphenyl)methyl]hydroxylamine (PubChem CID 117287016) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is N-[(2,3-dimethoxy-5-methylphenyl)methyl]hydroxylamine.
| Compound Name | N-[(2,3-dimethoxy-5-methylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117287016 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | N-[(2,3-dimethoxy-5-methylphenyl)methyl]hydroxylamine |
| SMILES | COc1cc(C)cc(CNO)c1OC |
| InChI | InChI=1S/C10H15NO3/c1-7-4-8(6-11-12)10(14-3)9(5-7)13-2/h4-5,11-12H,6H2,1-3H3 |
| InChIKey | WCGQUYMIOXIBDZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|