C11H16BrNO3 — CID 117468655
N-[(3-bromo-2-ethyl-4,5-dimethoxyphenyl)methyl]hydroxylamine (PubChem CID 117468655) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is N-[(3-bromo-2-ethyl-4,5-dimethoxyphenyl)methyl]hydroxylamine.
| Compound Name | N-[(3-bromo-2-ethyl-4,5-dimethoxyphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117468655 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-[(3-bromo-2-ethyl-4,5-dimethoxyphenyl)methyl]hydroxylamine |
| SMILES | CCc1c(CNO)cc(OC)c(OC)c1Br |
| InChI | InChI=1S/C11H16BrNO3/c1-4-8-7(6-13-14)5-9(15-2)11(16-3)10(8)12/h5,13-14H,4,6H2,1-3H3 |
| InChIKey | LXXCSHQBQHVDRD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|