C11H16BrNO3 — CID 82685518
N-[(3-bromo-5-methoxy-4-propoxyphenyl)methyl]hydroxylamine (PubChem CID 82685518) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-propoxyphenyl)methyl]hydroxylamine.
| Compound Name | N-[(3-bromo-5-methoxy-4-propoxyphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 82685518 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-propoxyphenyl)methyl]hydroxylamine |
| SMILES | CCCOc1c(Br)cc(CNO)cc1OC |
| InChI | InChI=1S/C11H16BrNO3/c1-3-4-16-11-9(12)5-8(7-13-14)6-10(11)15-2/h5-6,13-14H,3-4,7H2,1-2H3 |
| InChIKey | YRURUKXCBMRLCS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|