C19H24BrNO2 — CID 29227314
N-[(3-bromo-5-methoxy-4-propoxyphenyl)methyl]-1-(4-methylphenyl)methanamine (PubChem CID 29227314) has the molecular formula C19H24BrNO2 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-propoxyphenyl)methyl]-1-(4-methylphenyl)methanamine.
| Compound Name | N-[(3-bromo-5-methoxy-4-propoxyphenyl)methyl]-1-(4-methylphenyl)methanamine |
|---|---|
| PubChem CID | 29227314 |
| Molecular Formula | C19H24BrNO2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-propoxyphenyl)methyl]-1-(4-methylphenyl)methanamine |
| SMILES | CCCOc1c(Br)cc(CNCc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C19H24BrNO2/c1-4-9-23-19-17(20)10-16(11-18(19)22-3)13-21-12-15-7-5-14(2)6-8-15/h5-8,10-11,21H,4,9,12-13H2,1-3H3 |
| InChIKey | OLVFGZLQTKWFTM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |