C9H13NO4 — CID 117288363
3-[(hydroxyamino)methyl]-4,5-dimethoxyphenol (PubChem CID 117288363) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-[(hydroxyamino)methyl]-4,5-dimethoxyphenol.
| Compound Name | 3-[(hydroxyamino)methyl]-4,5-dimethoxyphenol |
|---|---|
| PubChem CID | 117288363 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-[(hydroxyamino)methyl]-4,5-dimethoxyphenol |
| SMILES | COc1cc(O)cc(CNO)c1OC |
| InChI | InChI=1S/C9H13NO4/c1-13-8-4-7(11)3-6(5-10-12)9(8)14-2/h3-4,10-12H,5H2,1-2H3 |
| InChIKey | HQQYNOUUUFHZAD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|