C9H13NO3 — CID 117279442
3-(aminomethyl)-4,5-dimethoxyphenol (PubChem CID 117279442) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-(aminomethyl)-4,5-dimethoxyphenol.
| Compound Name | 3-(aminomethyl)-4,5-dimethoxyphenol |
|---|---|
| PubChem CID | 117279442 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 3-(aminomethyl)-4,5-dimethoxyphenol |
| SMILES | COc1cc(O)cc(CN)c1OC |
| InChI | InChI=1S/C9H13NO3/c1-12-8-4-7(11)3-6(5-10)9(8)13-2/h3-4,11H,5,10H2,1-2H3 |
| InChIKey | JFSCSHGJWQZQIA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |