About 4-methoxy-3,5-bis(methylperoxy)phenol
4-methoxy-3,5-bis(methylperoxy)phenol (PubChem CID 174710880) has the molecular formula C9H12O6
and a molecular weight of 216.19 g/mol. Its IUPAC name is 4-methoxy-3,5-bis(methylperoxy)phenol.
Molecular Properties
| Compound Name | 4-methoxy-3,5-bis(methylperoxy)phenol |
| PubChem CID | 174710880 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 4-methoxy-3,5-bis(methylperoxy)phenol |
| SMILES | COOc1cc(O)cc(OOC)c1OC |
| InChI | InChI=1S/C9H12O6/c1-11-9-7(14-12-2)4-6(10)5-8(9)15-13-3/h4-5,10H,1-3H3 |
| InChIKey | RLBXTZGXXOEQPK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-3,5-bis(methylperoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,5-bis(methylperoxy)phenol?
The IUPAC name of 4-methoxy-3,5-bis(methylperoxy)phenol (CID 174710880) is 4-methoxy-3,5-bis(methylperoxy)phenol.
What is the SMILES notation for 4-methoxy-3,5-bis(methylperoxy)phenol?
The canonical SMILES for 4-methoxy-3,5-bis(methylperoxy)phenol is COOc1cc(O)cc(OOC)c1OC.
What is the InChIKey of 4-methoxy-3,5-bis(methylperoxy)phenol?
The InChIKey is RLBXTZGXXOEQPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O6/c1-11-9-7(14-12-2)4-6(10)5-8(9)15-13-3/h4-5,10H,1-3H3.
What are the key properties of 4-methoxy-3,5-bis(methylperoxy)phenol?
4-methoxy-3,5-bis(methylperoxy)phenol has a molecular weight of 216.19 g/mol, XLogP of 1.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,5-bis(methylperoxy)phenol is sourced from PubChem (CID 174710880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).