C7H7ClO3 — CID 130033872
4-chloro-5-methoxybenzene-1,3-diol (PubChem CID 130033872) has the molecular formula C7H7ClO3 and a molecular weight of 174.58 g/mol. Its IUPAC name is 4-chloro-5-methoxybenzene-1,3-diol.
| Compound Name | 4-chloro-5-methoxybenzene-1,3-diol |
|---|---|
| PubChem CID | 130033872 |
| Molecular Formula | C7H7ClO3 |
| Molecular Weight | 174.58 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | 4-chloro-5-methoxybenzene-1,3-diol |
| SMILES | COc1cc(O)cc(O)c1Cl |
| InChI | InChI=1S/C7H7ClO3/c1-11-6-3-4(9)2-5(10)7(6)8/h2-3,9-10H,1H3 |
| InChIKey | RIUKXKQJCWIJFF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.58 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |