About 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol
4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol (PubChem CID 14993626) has the molecular formula C16H18O6S
and a molecular weight of 338.38 g/mol. Its IUPAC name is 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol |
| PubChem CID | 14993626 |
| Molecular Formula | C16H18O6S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)cc(OC)c1Sc1c(OC)cc(O)cc1OC |
| InChI | InChI=1S/C16H18O6S/c1-19-11-5-9(17)6-12(20-2)15(11)23-16-13(21-3)7-10(18)8-14(16)22-4/h5-8,17-18H,1-4H3 |
| InChIKey | CAOQKHXQBPXWHF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol?
The IUPAC name of 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol (CID 14993626) is 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol.
What is the SMILES notation for 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol?
The canonical SMILES for 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol is COc1cc(O)cc(OC)c1Sc1c(OC)cc(O)cc1OC.
What is the InChIKey of 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol?
The InChIKey is CAOQKHXQBPXWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O6S/c1-19-11-5-9(17)6-12(20-2)15(11)23-16-13(21-3)7-10(18)8-14(16)22-4/h5-8,17-18H,1-4H3.
What are the key properties of 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol?
4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol has a molecular weight of 338.38 g/mol, XLogP of 3.28, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxy-2,6-dimethoxyphenyl)sulfanyl-3,5-dimethoxyphenol is sourced from PubChem (CID 14993626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).