C11H18O3 — CID 153353458
ethane;4-ethyl-5-methoxybenzene-1,3-diol (PubChem CID 153353458) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is ethane;4-ethyl-5-methoxybenzene-1,3-diol.
| Compound Name | ethane;4-ethyl-5-methoxybenzene-1,3-diol |
|---|---|
| PubChem CID | 153353458 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | ethane;4-ethyl-5-methoxybenzene-1,3-diol |
| SMILES | CC.CCc1c(O)cc(O)cc1OC |
| InChI | InChI=1S/C9H12O3.C2H6/c1-3-7-8(11)4-6(10)5-9(7)12-2;1-2/h4-5,10-11H,3H2,1-2H3;1-2H3 |
| InChIKey | SYFOJAZQWQIBOD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |