C12H16O3S — CID 154133859
O-methyl 4-ethyl-3,5-dimethoxybenzenecarbothioate (PubChem CID 154133859) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is O-methyl 4-ethyl-3,5-dimethoxybenzenecarbothioate.
| Compound Name | O-methyl 4-ethyl-3,5-dimethoxybenzenecarbothioate |
|---|---|
| PubChem CID | 154133859 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | O-methyl 4-ethyl-3,5-dimethoxybenzenecarbothioate |
| SMILES | CCc1c(OC)cc(C(=S)OC)cc1OC |
| InChI | InChI=1S/C12H16O3S/c1-5-9-10(13-2)6-8(12(16)15-4)7-11(9)14-3/h6-7H,5H2,1-4H3 |
| InChIKey | KBYSLHMYUXCNCK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|