C14H12N2O4 — CID 146380846
4,9-dimethoxyphenazine-2,7-diol (PubChem CID 146380846) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4,9-dimethoxyphenazine-2,7-diol.
| Compound Name | 4,9-dimethoxyphenazine-2,7-diol |
|---|---|
| PubChem CID | 146380846 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4,9-dimethoxyphenazine-2,7-diol |
| SMILES | COc1cc(O)cc2nc3c(OC)cc(O)cc3nc12 |
| InChI | InChI=1S/C14H12N2O4/c1-19-11-5-7(17)3-9-13(11)15-10-4-8(18)6-12(20-2)14(10)16-9/h3-6,17-18H,1-2H3 |
| InChIKey | CGKGATHBRYDYDY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|