C15H16N2O5S — CID 156832576
ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid (PubChem CID 156832576) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid.
| Compound Name | ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid |
|---|---|
| PubChem CID | 156832576 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid |
| SMILES | CC.COc1cc(O)cc2nc3cc(S(=O)(=O)O)ccc3nc12 |
| InChI | InChI=1S/C13H10N2O5S.C2H6/c1-20-12-5-7(16)4-11-13(12)15-9-3-2-8(21(17,18)19)6-10(9)14-11;1-2/h2-6,16H,1H3,(H,17,18,19);1-2H3 |
| InChIKey | QDDFTQMRJGVJNW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|