ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid

C15H16N2O5S — CID 156832576

IUPACethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid
SMILESCC.COc1cc(O)cc2nc3cc(S(=O)(=O)O)ccc3nc12
InChIInChI=1S/C13H10N2O5S.C2H6/c1-20-12-5-7(16)4-11-13(12)15-9-3-2-8(21(17,18)19)6-10(9)14-11;1-2/h2-6,16H,1H3,(H,17,18,19);1-2H3
InChIKeyQDDFTQMRJGVJNW-UHFFFAOYSA-N
MW336.37 g/mol
LogP2.77
Rot. Bonds2

About ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid

ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid (PubChem CID 156832576) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid.

Molecular Properties

Compound Nameethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid
PubChem CID156832576
Molecular FormulaC15H16N2O5S
Molecular Weight336.37 g/mol
Exact Mass336.08
IUPAC Nameethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid
SMILESCC.COc1cc(O)cc2nc3cc(S(=O)(=O)O)ccc3nc12
InChIInChI=1S/C13H10N2O5S.C2H6/c1-20-12-5-7(16)4-11-13(12)15-9-3-2-8(21(17,18)19)6-10(9)14-11;1-2/h2-6,16H,1H3,(H,17,18,19);1-2H3
InChIKeyQDDFTQMRJGVJNW-UHFFFAOYSA-N
XLogP2.77
TPSA109.61 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500336.37
LogP ≤ 52.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid?
The IUPAC name of ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid (CID 156832576) is ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid.
What is the SMILES notation for ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid?
The canonical SMILES for ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid is CC.COc1cc(O)cc2nc3cc(S(=O)(=O)O)ccc3nc12.
What is the InChIKey of ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid?
The InChIKey is QDDFTQMRJGVJNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O5S.C2H6/c1-20-12-5-7(16)4-11-13(12)15-9-3-2-8(21(17,18)19)6-10(9)14-11;1-2/h2-6,16H,1H3,(H,17,18,19);1-2H3.
What are the key properties of ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid?
ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid has a molecular weight of 336.37 g/mol, XLogP of 2.77, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-hydroxy-6-methoxyphenazine-2-sulfonic acid is sourced from PubChem (CID 156832576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).