C29H26N4O9S2 — CID 162245752
7-hydroxy-9-methoxy-3-methylphenazine-2-sulfonic acid;6-methoxy-3,8-dimethylphenazine-2-sulfonic acid (PubChem CID 162245752) has the molecular formula C29H26N4O9S2 and a molecular weight of 638.68 g/mol. Its IUPAC name is 7-hydroxy-9-methoxy-3-methylphenazine-2-sulfonic acid;6-methoxy-3,8-dimethylphenazine-2-sulfonic acid.
| Compound Name | 7-hydroxy-9-methoxy-3-methylphenazine-2-sulfonic acid;6-methoxy-3,8-dimethylphenazine-2-sulfonic acid |
|---|---|
| PubChem CID | 162245752 |
| Molecular Formula | C29H26N4O9S2 |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 638.11 |
| IUPAC Name | 7-hydroxy-9-methoxy-3-methylphenazine-2-sulfonic acid;6-methoxy-3,8-dimethylphenazine-2-sulfonic acid |
| SMILES | COc1cc(C)cc2nc3cc(S(=O)(=O)O)c(C)cc3nc12.COc1cc(O)cc2nc3cc(C)c(S(=O)(=O)O)cc3nc12 |
| InChI | InChI=1S/C15H14N2O4S.C14H12N2O5S/c1-8-4-12-15(13(5-8)21-3)17-10-6-9(2)14(22(18,19)20)7-11(10)16-12;1-7-3-9-10(6-13(7)22(18,19)20)16-14-11(15-9)4-8(17)5-12(14)21-2/h4-7H,1-3H3,(H,18,19,20);3-6,17H,1-2H3,(H,18,19,20) |
| InChIKey | ZXHQNIGRYMCMMV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 198.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|