C18H16N2O8S2 — CID 136669477
3-hydroxy-4-[(2-methoxy-5-methyl-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136669477) has the molecular formula C18H16N2O8S2 and a molecular weight of 452.47 g/mol. Its IUPAC name is 3-hydroxy-4-[(2-methoxy-5-methyl-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 3-hydroxy-4-[(2-methoxy-5-methyl-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136669477 |
| Molecular Formula | C18H16N2O8S2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 3-hydroxy-4-[(2-methoxy-5-methyl-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1cc(S(=O)(=O)O)c(C)cc1/N=N/c1c(O)c(S(=O)(=O)O)cc2ccccc12 |
| InChI | InChI=1S/C18H16N2O8S2/c1-10-7-13(14(28-2)9-15(10)29(22,23)24)19-20-17-12-6-4-3-5-11(12)8-16(18(17)21)30(25,26)27/h3-9,21H,1-2H3,(H,22,23,24)(H,25,26,27)/b20-19+ |
| InChIKey | PECBZOKMZSPPQY-FMQUCBEESA-N |
| XLogP | 3.77 |
| TPSA | 162.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|