C21H16N2O10S3 — CID 136594043
3-hydroxy-7-methoxysulfonyl-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136594043) has the molecular formula C21H16N2O10S3 and a molecular weight of 552.56 g/mol. Its IUPAC name is 3-hydroxy-7-methoxysulfonyl-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 3-hydroxy-7-methoxysulfonyl-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136594043 |
| Molecular Formula | C21H16N2O10S3 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | 3-hydroxy-7-methoxysulfonyl-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COS(=O)(=O)c1ccc2c(/N=N/c3ccc(S(=O)(=O)O)c4ccccc34)c(O)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C21H16N2O10S3/c1-33-36(31,32)13-6-7-14-12(10-13)11-19(35(28,29)30)21(24)20(14)23-22-17-8-9-18(34(25,26)27)16-5-3-2-4-15(16)17/h2-11,24H,1H3,(H,25,26,27)(H,28,29,30)/b23-22+ |
| InChIKey | ZCYKEDOLMGRYBF-GHVJWSGMSA-N |
| XLogP | 3.94 |
| TPSA | 197.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|