C14H12N2O5 — CID 166717796
8-(dihydroxymethyl)-6-methoxyphenazine-2,3-diol (PubChem CID 166717796) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is 8-(dihydroxymethyl)-6-methoxyphenazine-2,3-diol.
| Compound Name | 8-(dihydroxymethyl)-6-methoxyphenazine-2,3-diol |
|---|---|
| PubChem CID | 166717796 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 8-(dihydroxymethyl)-6-methoxyphenazine-2,3-diol |
| SMILES | COc1cc(C(O)O)cc2nc3cc(O)c(O)cc3nc12 |
| InChI | InChI=1S/C14H12N2O5/c1-21-12-3-6(14(19)20)2-9-13(12)16-8-5-11(18)10(17)4-7(8)15-9/h2-5,14,17-20H,1H3 |
| InChIKey | XERJGUPLDOOIID-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|