C16H18O4 — CID 174965052
4-[1-(3,4-dimethoxyphenyl)ethyl]benzene-1,2-diol (PubChem CID 174965052) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-[1-(3,4-dimethoxyphenyl)ethyl]benzene-1,2-diol.
| Compound Name | 4-[1-(3,4-dimethoxyphenyl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 174965052 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-[1-(3,4-dimethoxyphenyl)ethyl]benzene-1,2-diol |
| SMILES | COc1ccc(C(C)c2ccc(O)c(O)c2)cc1OC |
| InChI | InChI=1S/C16H18O4/c1-10(11-4-6-13(17)14(18)8-11)12-5-7-15(19-2)16(9-12)20-3/h4-10,17-18H,1-3H3 |
| InChIKey | GMYCHEDBBZPKFD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|