C10H13F2NO2 — CID 28973213
(1S)-1-(3,4-dimethoxyphenyl)-2,2-difluoroethanamine (PubChem CID 28973213) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is (1S)-1-(3,4-dimethoxyphenyl)-2,2-difluoroethanamine.
| Compound Name | (1S)-1-(3,4-dimethoxyphenyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 28973213 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (1S)-1-(3,4-dimethoxyphenyl)-2,2-difluoroethanamine |
| SMILES | COc1ccc([C@H](N)C(F)F)cc1OC |
| InChI | InChI=1S/C10H13F2NO2/c1-14-7-4-3-6(5-8(7)15-2)9(13)10(11)12/h3-5,9-10H,13H2,1-2H3/t9-/m0/s1 |
| InChIKey | GUSFLXFAGOJWPI-VIFPVBQESA-N |
| XLogP | 1.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |