C11H14F3NO3 — CID 171160776
(2R,3R)-3-amino-3-(3,4-dimethoxyphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 171160776) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is (2R,3R)-3-amino-3-(3,4-dimethoxyphenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R,3R)-3-amino-3-(3,4-dimethoxyphenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 171160776 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (2R,3R)-3-amino-3-(3,4-dimethoxyphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | COc1ccc([C@@H](N)[C@@H](O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C11H14F3NO3/c1-17-7-4-3-6(5-8(7)18-2)9(15)10(16)11(12,13)14/h3-5,9-10,16H,15H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | VJBZDVZXXWVUCO-NXEZZACHSA-N |
| XLogP | 1.63 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |