C11H14F3NO2 — CID 70589172
2-(3,4-dimethoxyphenyl)-3,3,3-trifluoropropan-1-amine (PubChem CID 70589172) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 70589172 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3,3,3-trifluoropropan-1-amine |
| SMILES | COc1ccc(C(CN)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C11H14F3NO2/c1-16-9-4-3-7(5-10(9)17-2)8(6-15)11(12,13)14/h3-5,8H,6,15H2,1-2H3 |
| InChIKey | KBLIBWQKVAGTTE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |