C29H36O6 — CID 18764779
4-[bis(2-tert-butyl-3-hydroxy-6-methoxyphenyl)methyl]benzene-1,2-diol (PubChem CID 18764779) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is 4-[bis(2-tert-butyl-3-hydroxy-6-methoxyphenyl)methyl]benzene-1,2-diol.
| Compound Name | 4-[bis(2-tert-butyl-3-hydroxy-6-methoxyphenyl)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 18764779 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 4-[bis(2-tert-butyl-3-hydroxy-6-methoxyphenyl)methyl]benzene-1,2-diol |
| SMILES | COc1ccc(O)c(C(C)(C)C)c1C(c1ccc(O)c(O)c1)c1c(OC)ccc(O)c1C(C)(C)C |
| InChI | InChI=1S/C29H36O6/c1-28(2,3)26-18(31)11-13-21(34-7)24(26)23(16-9-10-17(30)20(33)15-16)25-22(35-8)14-12-19(32)27(25)29(4,5)6/h9-15,23,30-33H,1-8H3 |
| InChIKey | URRQDNRGDQSSSZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|