C24H26O4 — CID 18966010
4-[(4-hydroxy-2,6-dimethylphenyl)-(4-hydroxy-3-methoxyphenyl)methyl]-3,5-dimethylphenol (PubChem CID 18966010) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-[(4-hydroxy-2,6-dimethylphenyl)-(4-hydroxy-3-methoxyphenyl)methyl]-3,5-dimethylphenol.
| Compound Name | 4-[(4-hydroxy-2,6-dimethylphenyl)-(4-hydroxy-3-methoxyphenyl)methyl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 18966010 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-[(4-hydroxy-2,6-dimethylphenyl)-(4-hydroxy-3-methoxyphenyl)methyl]-3,5-dimethylphenol |
| SMILES | COc1cc(C(c2c(C)cc(O)cc2C)c2c(C)cc(O)cc2C)ccc1O |
| InChI | InChI=1S/C24H26O4/c1-13-8-18(25)9-14(2)22(13)24(17-6-7-20(27)21(12-17)28-5)23-15(3)10-19(26)11-16(23)4/h6-12,24-27H,1-5H3 |
| InChIKey | VFLCDUSVJHFPLX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|