C27H32O4 — CID 22338915
2-[(3-ethoxy-4-hydroxyphenyl)-(2-hydroxy-3,4,6-trimethylphenyl)methyl]-3,5,6-trimethylphenol (PubChem CID 22338915) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[(3-ethoxy-4-hydroxyphenyl)-(2-hydroxy-3,4,6-trimethylphenyl)methyl]-3,5,6-trimethylphenol.
| Compound Name | 2-[(3-ethoxy-4-hydroxyphenyl)-(2-hydroxy-3,4,6-trimethylphenyl)methyl]-3,5,6-trimethylphenol |
|---|---|
| PubChem CID | 22338915 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-[(3-ethoxy-4-hydroxyphenyl)-(2-hydroxy-3,4,6-trimethylphenyl)methyl]-3,5,6-trimethylphenol |
| SMILES | CCOc1cc(C(c2c(C)cc(C)c(C)c2O)c2c(C)cc(C)c(C)c2O)ccc1O |
| InChI | InChI=1S/C27H32O4/c1-8-31-22-13-20(9-10-21(22)28)25(23-16(4)11-14(2)18(6)26(23)29)24-17(5)12-15(3)19(7)27(24)30/h9-13,25,28-30H,8H2,1-7H3 |
| InChIKey | SURLJKLDKTYUEA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|