C19H24O2 — CID 61088282
(4-ethoxyphenyl)-(2,3,5,6-tetramethylphenyl)methanol (PubChem CID 61088282) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (4-ethoxyphenyl)-(2,3,5,6-tetramethylphenyl)methanol.
| Compound Name | (4-ethoxyphenyl)-(2,3,5,6-tetramethylphenyl)methanol |
|---|---|
| PubChem CID | 61088282 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (4-ethoxyphenyl)-(2,3,5,6-tetramethylphenyl)methanol |
| SMILES | CCOc1ccc(C(O)c2c(C)c(C)cc(C)c2C)cc1 |
| InChI | InChI=1S/C19H24O2/c1-6-21-17-9-7-16(8-10-17)19(20)18-14(4)12(2)11-13(3)15(18)5/h7-11,19-20H,6H2,1-5H3 |
| InChIKey | IMFGQSXNRYPBLO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |