C19H23BrO — CID 63442220
3-[bromo-(4-ethoxyphenyl)methyl]-1,2,4,5-tetramethylbenzene (PubChem CID 63442220) has the molecular formula C19H23BrO and a molecular weight of 347.30 g/mol. Its IUPAC name is 3-[bromo-(4-ethoxyphenyl)methyl]-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-[bromo-(4-ethoxyphenyl)methyl]-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 63442220 |
| Molecular Formula | C19H23BrO |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 3-[bromo-(4-ethoxyphenyl)methyl]-1,2,4,5-tetramethylbenzene |
| SMILES | CCOc1ccc(C(Br)c2c(C)c(C)cc(C)c2C)cc1 |
| InChI | InChI=1S/C19H23BrO/c1-6-21-17-9-7-16(8-10-17)19(20)18-14(4)12(2)11-13(3)15(18)5/h7-11,19H,6H2,1-5H3 |
| InChIKey | ZFSJPZLAGXNHJH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|