C17H18BrFO — CID 106880050
2-[bromo-(4-ethoxyphenyl)methyl]-5-fluoro-1,3-dimethylbenzene (PubChem CID 106880050) has the molecular formula C17H18BrFO and a molecular weight of 337.23 g/mol. Its IUPAC name is 2-[bromo-(4-ethoxyphenyl)methyl]-5-fluoro-1,3-dimethylbenzene.
| Compound Name | 2-[bromo-(4-ethoxyphenyl)methyl]-5-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 106880050 |
| Molecular Formula | C17H18BrFO |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-[bromo-(4-ethoxyphenyl)methyl]-5-fluoro-1,3-dimethylbenzene |
| SMILES | CCOc1ccc(C(Br)c2c(C)cc(F)cc2C)cc1 |
| InChI | InChI=1S/C17H18BrFO/c1-4-20-15-7-5-13(6-8-15)17(18)16-11(2)9-14(19)10-12(16)3/h5-10,17H,4H2,1-3H3 |
| InChIKey | FAWSRARQYAQYBH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|