C10H14O2 — CID 119015224
6-ethoxy-2,3-dimethylphenol (PubChem CID 119015224) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 6-ethoxy-2,3-dimethylphenol.
| Compound Name | 6-ethoxy-2,3-dimethylphenol |
|---|---|
| PubChem CID | 119015224 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 6-ethoxy-2,3-dimethylphenol |
| SMILES | CCOc1ccc(C)c(C)c1O |
| InChI | InChI=1S/C10H14O2/c1-4-12-9-6-5-7(2)8(3)10(9)11/h5-6,11H,4H2,1-3H3 |
| InChIKey | MBWFZSHOWONRQV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |