C13H16O5 — CID 67291987
3-methyl-6-propoxybenzene-1,2-diol;oxet-2-one (PubChem CID 67291987) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-methyl-6-propoxybenzene-1,2-diol;oxet-2-one.
| Compound Name | 3-methyl-6-propoxybenzene-1,2-diol;oxet-2-one |
|---|---|
| PubChem CID | 67291987 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-methyl-6-propoxybenzene-1,2-diol;oxet-2-one |
| SMILES | CCCOc1ccc(C)c(O)c1O.O=C1C=CO1 |
| InChI | InChI=1S/C10H14O3.C3H2O2/c1-3-6-13-8-5-4-7(2)9(11)10(8)12;4-3-1-2-5-3/h4-5,11-12H,3,6H2,1-2H3;1-2H |
| InChIKey | ZUOATYQUFVHLTN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|