C11H14O2 — CID 151188668
2-ethyl-5-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 151188668) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-ethyl-5-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 2-ethyl-5-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 151188668 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-ethyl-5-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | CCCOc1ccc(CC)c2c1O2 |
| InChI | InChI=1S/C11H14O2/c1-3-7-12-9-6-5-8(4-2)10-11(9)13-10/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | NFVSHFFFNAANEM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|